A series of Brønsted-Lewis acidic ionic liquids were synthesized by homotaurine, ZnCl2 and HCl as the raw meterial. The cation of the ionic liquids can provide Brønsted acid and the anion can provide Lewis acid. The ionic liquids were characterized by FTIR, 1HNMR, 13CNMR and EA. The Brønsted acidity, Lewis acidity and corrosiveness of the ionic liquids were tested. The ionic liquids were used as the catalysts synthesizing n-butyl acetate and the optimal conditions was explored by response surface method. The results showed that the temperature is 103℃, the amounts of the catalyst is 10.03% of the mass of n-butanol, n(acetic acid)∶n(n-butanol)=1∶1.22, the reaction time is 4.92h, the amounts of cyclohexane is 20% of the mass of n-butanol, the yield can reach 97.28%. Furthermore, [NH3C3H6SO3H]Cl/0.75ZnCl2 was reused for 5 times, and it still had high catalytic activity.